Lilolidine
Catalog No: FT-0653200
CAS No: 5840-01-7
- Chemical Name: Lilolidine
- Molecular Formula: C11H11N
- Molecular Weight: 157.21 g/mol
- InChI Key: QCCKSFHMARIKSK-UHFFFAOYSA-N
- InChI: InChI=1S/C11H11N/c1-3-9-5-2-7-12-8-6-10(4-1)11(9)12/h1,3-4,6,8H,2,5,7H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 5,6-Dihydro-4H-pyrrolo[3,2,1-ij]quinoline |
|---|---|
| Flash_Point: | 146.3±19.3 °C |
| Melting_Point: | 86.5-88ºC |
| FW: | 157.212 |
| Density: | 1.2±0.1 g/cm3 |
| CAS: | 5840-01-7 |
| Bolling_Point: | 318.4±11.0 °C at 760 mmHg |
| MF: | C11H11N |
| Density: | 1.2±0.1 g/cm3 |
|---|---|
| LogP: | 3.12 |
| Flash_Point: | 146.3±19.3 °C |
| Melting_Point: | 86.5-88ºC |
| FW: | 157.212 |
| PSA: | 4.93000 |
| Exact_Mass: | 157.089142 |
| MF: | C11H11N |
| Bolling_Point: | 318.4±11.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| Refractive_Index: | 1.656 |
Related Products
(3aS,5aR,6aR,6bS)-4-bromo-2,2-dimethyl-3a,5a,6a,6b-tetrahydrooxireno[2,3-g][1,3]benzodioxole
2-hydroxy-4-[(2Z)-2-(8-hydroxy-1-oxo-3,6-disulfonaphthalen-2-ylidene)hydrazinyl]benzoic acid
Silicic acid,sodium salt,reaction products with chlorotrimethylsilane and iso-Pr alc.